C12H8N4O6 — CID 21329304
N-(1,3-benzodioxol-5-yl)-3,5-dinitropyridin-2-amine (PubChem CID 21329304) has the molecular formula C12H8N4O6 and a molecular weight of 304.22 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3,5-dinitropyridin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 21329304 |
| Molecular Formula | C12H8N4O6 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3,5-dinitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccc3c(c2)OCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8N4O6/c17-15(18)8-4-9(16(19)20)12(13-5-8)14-7-1-2-10-11(3-7)22-6-21-10/h1-5H,6H2,(H,13,14) |
| InChIKey | GDCAFOWROWYWJL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|