C20H14N6O4 — CID 23480603
6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 23480603) has the molecular formula C20H14N6O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480603 |
| Molecular Formula | C20H14N6O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCO3)ncnc1Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H14N6O4/c27-26(28)18-19(24-13-6-7-15-16(9-13)30-11-29-15)22-10-23-20(18)25-14-5-1-3-12-4-2-8-21-17(12)14/h1-10H,11H2,(H2,22,23,24,25) |
| InChIKey | RMUGAOSCUXYQLD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|