C18H14ClN5O4 — CID 22530516
4-N-(2-chlorophenyl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22530516) has the molecular formula C18H14ClN5O4 and a molecular weight of 399.79 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-chlorophenyl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22530516 |
| Molecular Formula | C18H14ClN5O4 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-N-(2-chlorophenyl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCCO3)ncnc1Nc1ccccc1Cl |
| InChI | InChI=1S/C18H14ClN5O4/c19-12-3-1-2-4-13(12)23-18-16(24(25)26)17(20-10-21-18)22-11-5-6-14-15(9-11)28-8-7-27-14/h1-6,9-10H,7-8H2,(H2,20,21,22,23) |
| InChIKey | IAAOGLFSTBEWMX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|