C20H17N5O5 — CID 23486115
1-[3-[[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 23486115) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is 1-[3-[[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 23486115 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-[3-[[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc(Nc3ccc4c(c3)OCCO4)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N5O5/c1-12(26)13-3-2-4-14(9-13)23-19-18(25(27)28)20(22-11-21-19)24-15-5-6-16-17(10-15)30-8-7-29-16/h2-6,9-11H,7-8H2,1H3,(H2,21,22,23,24) |
| InChIKey | PMDVBACRAUWGAS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|