C17H15N5O5 — CID 22528626
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22528626) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528626 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2ccco2)ncnc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15N5O5/c23-22(24)15-16(18-9-12-2-1-5-25-12)19-10-20-17(15)21-11-3-4-13-14(8-11)27-7-6-26-13/h1-5,8,10H,6-7,9H2,(H2,18,19,20,21) |
| InChIKey | SIZRGDFPLAVMHB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|