C19H16FN5O4 — CID 22530601
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 22530601) has the molecular formula C19H16FN5O4 and a molecular weight of 397.37 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22530601 |
| Molecular Formula | C19H16FN5O4 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(F)cc2)ncnc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H16FN5O4/c20-13-3-1-12(2-4-13)10-21-18-17(25(26)27)19(23-11-22-18)24-14-5-6-15-16(9-14)29-8-7-28-15/h1-6,9,11H,7-8,10H2,(H2,21,22,23,24) |
| InChIKey | XVWSAMPIPFIFNP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|