C17H12BrF2N5O2 — CID 22537720
4-N-(4-bromo-2-fluorophenyl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 22537720) has the molecular formula C17H12BrF2N5O2 and a molecular weight of 436.22 g/mol. Its IUPAC name is 4-N-(4-bromo-2-fluorophenyl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-bromo-2-fluorophenyl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22537720 |
| Molecular Formula | C17H12BrF2N5O2 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 4-N-(4-bromo-2-fluorophenyl)-6-N-[(4-fluorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(F)cc2)ncnc1Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H12BrF2N5O2/c18-11-3-6-14(13(20)7-11)24-17-15(25(26)27)16(22-9-23-17)21-8-10-1-4-12(19)5-2-10/h1-7,9H,8H2,(H2,21,22,23,24) |
| InChIKey | GGKCVWLGQKBAPY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|