C19H14F3N5O4 — CID 23481171
6-N-(1,3-benzodioxol-5-ylmethyl)-5-nitro-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 23481171) has the molecular formula C19H14F3N5O4 and a molecular weight of 433.35 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-ylmethyl)-5-nitro-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-5-nitro-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481171 |
| Molecular Formula | C19H14F3N5O4 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-5-nitro-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc3c(c2)OCO3)ncnc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3N5O4/c20-19(21,22)12-2-4-13(5-3-12)26-18-16(27(28)29)17(24-9-25-18)23-8-11-1-6-14-15(7-11)31-10-30-14/h1-7,9H,8,10H2,(H2,23,24,25,26) |
| InChIKey | YYRFXFRBGKWJLZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|