C16H19N5O4 — CID 23481183
6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-butan-2-yl-5-nitropyrimidine-4,6-diamine (PubChem CID 23481183) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-butan-2-yl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-butan-2-yl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481183 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-butan-2-yl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCC(C)Nc1ncnc(NCc2ccc3c(c2)OCO3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N5O4/c1-3-10(2)20-16-14(21(22)23)15(18-8-19-16)17-7-11-4-5-12-13(6-11)25-9-24-12/h4-6,8,10H,3,7,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | PDTAQSDARXATCB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|