C20H17ClN4O5 — CID 23481159
N-(1,3-benzodioxol-5-ylmethyl)-6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 23481159) has the molecular formula C20H17ClN4O5 and a molecular weight of 428.83 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23481159 |
| Molecular Formula | C20H17ClN4O5 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(Oc2ncnc(NCc3ccc4c(c3)OCO4)c2[N+](=O)[O-])cc(C)c1Cl |
| InChI | InChI=1S/C20H17ClN4O5/c1-11-5-14(6-12(2)17(11)21)30-20-18(25(26)27)19(23-9-24-20)22-8-13-3-4-15-16(7-13)29-10-28-15/h3-7,9H,8,10H2,1-2H3,(H,22,23,24) |
| InChIKey | OSRUAHFUFCCITN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|