C19H15N7O7 — CID 23481124
N'-[6-(1,3-benzodioxol-5-ylmethylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide (PubChem CID 23481124) has the molecular formula C19H15N7O7 and a molecular weight of 453.37 g/mol. Its IUPAC name is N'-[6-(1,3-benzodioxol-5-ylmethylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide.
| Compound Name | N'-[6-(1,3-benzodioxol-5-ylmethylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23481124 |
| Molecular Formula | C19H15N7O7 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N'-[6-(1,3-benzodioxol-5-ylmethylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NCc2ccc3c(c2)OCO3)c1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N7O7/c27-19(12-3-1-2-4-13(12)25(28)29)24-23-18-16(26(30)31)17(21-9-22-18)20-8-11-5-6-14-15(7-11)33-10-32-14/h1-7,9H,8,10H2,(H,24,27)(H2,20,21,22,23) |
| InChIKey | ZMWUANRGQRKWNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|