C22H21ClN6O4 — CID 23481027
N-(1,3-benzodioxol-5-ylmethyl)-6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 23481027) has the molecular formula C22H21ClN6O4 and a molecular weight of 468.90 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23481027 |
| Molecular Formula | C22H21ClN6O4 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc3c(c2)OCO3)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H21ClN6O4/c23-16-2-1-3-17(11-16)27-6-8-28(9-7-27)22-20(29(30)31)21(25-13-26-22)24-12-15-4-5-18-19(10-15)33-14-32-18/h1-5,10-11,13H,6-9,12,14H2,(H,24,25,26) |
| InChIKey | MXSTYBYWSDXQNB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|