C22H22N6O4 — CID 22531857
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine (PubChem CID 22531857) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 22531857 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H22N6O4/c29-28(30)20-21(25-17-4-2-1-3-5-17)23-14-24-22(20)27-10-8-26(9-11-27)13-16-6-7-18-19(12-16)32-15-31-18/h1-7,12,14H,8-11,13,15H2,(H,23,24,25) |
| InChIKey | ONQHYEJMOISEJZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|