C24H24N6O6 — CID 22533766
methyl 4-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533766) has the molecular formula C24H24N6O6 and a molecular weight of 492.49 g/mol. Its IUPAC name is methyl 4-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533766 |
| Molecular Formula | C24H24N6O6 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | methyl 4-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H24N6O6/c1-34-24(31)17-3-5-18(6-4-17)27-22-21(30(32)33)23(26-14-25-22)29-10-8-28(9-11-29)13-16-2-7-19-20(12-16)36-15-35-19/h2-7,12,14H,8-11,13,15H2,1H3,(H,25,26,27) |
| InChIKey | JSQPJHFNZVRAPL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|