C22H26N6O8 — CID 3703126
methyl 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 3703126) has the molecular formula C22H26N6O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is methyl 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 3703126 |
| Molecular Formula | C22H26N6O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N6O8/c1-33-18(29)11-27(12-19(30)34-2)22-20(28(31)32)21(23-13-24-22)26-7-5-25(6-8-26)10-15-3-4-16-17(9-15)36-14-35-16/h3-4,9,13H,5-8,10-12,14H2,1-2H3 |
| InChIKey | RLURQXJVCOLSSB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 149.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|