C22H28N6O6 — CID 3817334
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(1,3-dioxolan-2-yl)ethyl]-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 3817334) has the molecular formula C22H28N6O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(1,3-dioxolan-2-yl)ethyl]-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(1,3-dioxolan-2-yl)ethyl]-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3817334 |
| Molecular Formula | C22H28N6O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(1,3-dioxolan-2-yl)ethyl]-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CN(CCC1OCCO1)c1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N6O6/c1-25(5-4-19-31-10-11-32-19)21-20(28(29)30)22(24-14-23-21)27-8-6-26(7-9-27)13-16-2-3-17-18(12-16)34-15-33-17/h2-3,12,14,19H,4-11,13,15H2,1H3 |
| InChIKey | FRDOVCSMCUWDKI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|