C29H33N7O4 — CID 3324253
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidine (PubChem CID 3324253) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 3324253 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidine |
| SMILES | O=[N+]([O-])c1c(N2CCN(CC=Cc3ccccc3)CC2)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C29H33N7O4/c37-36(38)27-28(34-15-11-32(12-16-34)10-4-7-23-5-2-1-3-6-23)30-21-31-29(27)35-17-13-33(14-18-35)20-24-8-9-25-26(19-24)40-22-39-25/h1-9,19,21H,10-18,20,22H2 |
| InChIKey | CXPMBOYKYUJTEX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|