C22H21BrN6O4 — CID 22532217
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2-bromophenyl)-5-nitropyrimidin-4-amine (PubChem CID 22532217) has the molecular formula C22H21BrN6O4 and a molecular weight of 513.35 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2-bromophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2-bromophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22532217 |
| Molecular Formula | C22H21BrN6O4 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2-bromophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2Br)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H21BrN6O4/c23-16-3-1-2-4-17(16)26-21-20(29(30)31)22(25-13-24-21)28-9-7-27(8-10-28)12-15-5-6-18-19(11-15)33-14-32-18/h1-6,11,13H,7-10,12,14H2,(H,24,25,26) |
| InChIKey | ALYHDDMRLZYOLJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|