C23H25N7O4 — CID 3561814
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(2-pyridin-2-ylethyl)pyrimidin-4-amine (PubChem CID 3561814) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(2-pyridin-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(2-pyridin-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3561814 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(2-pyridin-2-ylethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCc2ccccn2)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H25N7O4/c31-30(32)21-22(25-8-6-18-3-1-2-7-24-18)26-15-27-23(21)29-11-9-28(10-12-29)14-17-4-5-19-20(13-17)34-16-33-19/h1-5,7,13,15H,6,8-12,14,16H2,(H,25,26,27) |
| InChIKey | LWINEMKWGNXMMW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|