C26H30N6O6 — CID 3865789
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(2,3-dimethoxyphenyl)ethyl]-5-nitropyrimidin-4-amine (PubChem CID 3865789) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(2,3-dimethoxyphenyl)ethyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(2,3-dimethoxyphenyl)ethyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3865789 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[2-(2,3-dimethoxyphenyl)ethyl]-5-nitropyrimidin-4-amine |
| SMILES | COc1cccc(CCNc2ncnc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C26H30N6O6/c1-35-21-5-3-4-19(24(21)36-2)8-9-27-25-23(32(33)34)26(29-16-28-25)31-12-10-30(11-13-31)15-18-6-7-20-22(14-18)38-17-37-20/h3-7,14,16H,8-13,15,17H2,1-2H3,(H,27,28,29) |
| InChIKey | LCGHMLHHSCDFRL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|