C28H32N6O6 — CID 3465858
benzyl 5-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]pentanoate (PubChem CID 3465858) has the molecular formula C28H32N6O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is benzyl 5-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]pentanoate.
| Compound Name | benzyl 5-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]pentanoate |
|---|---|
| PubChem CID | 3465858 |
| Molecular Formula | C28H32N6O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | benzyl 5-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]pentanoate |
| SMILES | O=C(CCCCNc1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C28H32N6O6/c35-25(38-18-21-6-2-1-3-7-21)8-4-5-11-29-27-26(34(36)37)28(31-19-30-27)33-14-12-32(13-15-33)17-22-9-10-23-24(16-22)40-20-39-23/h1-3,6-7,9-10,16,19H,4-5,8,11-15,17-18,20H2,(H,29,30,31) |
| InChIKey | FABXTYLLLQXDKG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|