C19H17Cl2N7O2 — CID 23491144
6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine (PubChem CID 23491144) has the molecular formula C19H17Cl2N7O2 and a molecular weight of 446.30 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491144 |
| Molecular Formula | C19H17Cl2N7O2 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccnc2Cl)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H17Cl2N7O2/c20-13-3-1-4-14(11-13)26-7-9-27(10-8-26)19-16(28(29)30)18(23-12-24-19)25-15-5-2-6-22-17(15)21/h1-6,11-12H,7-10H2,(H,23,24,25) |
| InChIKey | FZNQVVYDRYIDGB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|