C21H27ClN6O2 — CID 23491131
6-[4-(3-chlorophenyl)piperazin-1-yl]-N-cycloheptyl-5-nitropyrimidin-4-amine (PubChem CID 23491131) has the molecular formula C21H27ClN6O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-cycloheptyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-cycloheptyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491131 |
| Molecular Formula | C21H27ClN6O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-cycloheptyl-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NC2CCCCCC2)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H27ClN6O2/c22-16-6-5-9-18(14-16)26-10-12-27(13-11-26)21-19(28(29)30)20(23-15-24-21)25-17-7-3-1-2-4-8-17/h5-6,9,14-15,17H,1-4,7-8,10-13H2,(H,23,24,25) |
| InChIKey | AYOFSUNKXJSEKP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|