C18H22N6O3 — CID 3607385
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 3607385) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3607385 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CN1CCN(c2ncnc(NCc3ccc4c(c3)CCO4)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H22N6O3/c1-22-5-7-23(8-6-22)18-16(24(25)26)17(20-12-21-18)19-11-13-2-3-15-14(10-13)4-9-27-15/h2-3,10,12H,4-9,11H2,1H3,(H,19,20,21) |
| InChIKey | BHYCMIZAQDSEGO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|