C16H16F3N5O3 — CID 3711625
6-morpholin-4-yl-5-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 3711625) has the molecular formula C16H16F3N5O3 and a molecular weight of 383.33 g/mol. Its IUPAC name is 6-morpholin-4-yl-5-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-morpholin-4-yl-5-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3711625 |
| Molecular Formula | C16H16F3N5O3 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 6-morpholin-4-yl-5-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2cccc(C(F)(F)F)c2)ncnc1N1CCOCC1 |
| InChI | InChI=1S/C16H16F3N5O3/c17-16(18,19)12-3-1-2-11(8-12)9-20-14-13(24(25)26)15(22-10-21-14)23-4-6-27-7-5-23/h1-3,8,10H,4-7,9H2,(H,20,21,22) |
| InChIKey | QXQBUFPJCHKXLD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|