C21H19F4N7O2 — CID 3713516
N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 3713516) has the molecular formula C21H19F4N7O2 and a molecular weight of 477.42 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3713516 |
| Molecular Formula | C21H19F4N7O2 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(F)c(C(F)(F)F)c2)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H19F4N7O2/c22-16-5-4-14(11-15(16)21(23,24)25)12-27-19-18(32(33)34)20(29-13-28-19)31-9-7-30(8-10-31)17-3-1-2-6-26-17/h1-6,11,13H,7-10,12H2,(H,27,28,29) |
| InChIKey | LPWUKEFLEVINGF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|