C28H27ClN6O2 — CID 23491599
6-(4-benzhydrylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 23491599) has the molecular formula C28H27ClN6O2 and a molecular weight of 515.02 g/mol. Its IUPAC name is 6-(4-benzhydrylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzhydrylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491599 |
| Molecular Formula | C28H27ClN6O2 |
| Molecular Weight | 515.02 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 6-(4-benzhydrylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(Cl)cc2)ncnc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H27ClN6O2/c29-24-13-11-21(12-14-24)19-30-27-26(35(36)37)28(32-20-31-27)34-17-15-33(16-18-34)25(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,20,25H,15-19H2,(H,30,31,32) |
| InChIKey | AXWOMXPIIUXSLM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|