C31H32FN7O2 — CID 23491653
4-(4-benzhydrylpiperazin-1-yl)-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidine (PubChem CID 23491653) has the molecular formula C31H32FN7O2 and a molecular weight of 553.64 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidine.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidine |
|---|---|
| PubChem CID | 23491653 |
| Molecular Formula | C31H32FN7O2 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1c(N2CCN(c3ccccc3F)CC2)ncnc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H32FN7O2/c32-26-13-7-8-14-27(26)35-15-19-37(20-16-35)30-29(39(40)41)31(34-23-33-30)38-21-17-36(18-22-38)28(24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-14,23,28H,15-22H2 |
| InChIKey | GJQBYWFHENRKFD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 81.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|