C21H25FN6O4 — CID 3758590
8-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 3758590) has the molecular formula C21H25FN6O4 and a molecular weight of 444.47 g/mol. Its IUPAC name is 8-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 3758590 |
| Molecular Formula | C21H25FN6O4 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 8-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1c(N2CCN(c3ccccc3F)CC2)ncnc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C21H25FN6O4/c22-16-3-1-2-4-17(16)25-9-11-27(12-10-25)20-18(28(29)30)19(23-15-24-20)26-7-5-21(6-8-26)31-13-14-32-21/h1-4,15H,5-14H2 |
| InChIKey | OCUOMNCKMLFVNN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|