C13H16FNO2 — CID 20610156
8-(2-fluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 20610156) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2-fluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 20610156 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 8-(2-fluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | Fc1ccccc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H16FNO2/c14-11-3-1-2-4-12(11)15-7-5-13(6-8-15)16-9-10-17-13/h1-4H,5-10H2 |
| InChIKey | HOMPIXQNBLWFMC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |