C28H27FN6O2 — CID 23488416
N,N-dibenzyl-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 23488416) has the molecular formula C28H27FN6O2 and a molecular weight of 498.56 g/mol. Its IUPAC name is N,N-dibenzyl-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N,N-dibenzyl-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488416 |
| Molecular Formula | C28H27FN6O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N,N-dibenzyl-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(N2CCN(c3ccccc3F)CC2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H27FN6O2/c29-24-13-7-8-14-25(24)32-15-17-33(18-16-32)27-26(35(36)37)28(31-21-30-27)34(19-22-9-3-1-4-10-22)20-23-11-5-2-6-12-23/h1-14,21H,15-20H2 |
| InChIKey | XRSWSYRTTIYIJP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|