C18H20N6O3 — CID 3725451
3-[benzyl-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]propanenitrile (PubChem CID 3725451) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-[benzyl-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]propanenitrile.
| Compound Name | 3-[benzyl-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 3725451 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[benzyl-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccccc1)c1ncnc(N2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N6O3/c19-7-4-8-23(13-15-5-2-1-3-6-15)18-16(24(25)26)17(20-14-21-18)22-9-11-27-12-10-22/h1-3,5-6,14H,4,8-13H2 |
| InChIKey | CVTIHPIIXBZWLG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|