C17H17N7O2 — CID 23493458
3-[2-cyanoethyl-[6-(N-methylanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile (PubChem CID 23493458) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 3-[2-cyanoethyl-[6-(N-methylanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[2-cyanoethyl-[6-(N-methylanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 23493458 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-[2-cyanoethyl-[6-(N-methylanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile |
| SMILES | CN(c1ccccc1)c1ncnc(N(CCC#N)CCC#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N7O2/c1-22(14-7-3-2-4-8-14)16-15(24(25)26)17(21-13-20-16)23(11-5-9-18)12-6-10-19/h2-4,7-8,13H,5-6,11-12H2,1H3 |
| InChIKey | OLQUMUNCSCVQFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 122.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|