C16H15N7O2 — CID 23478204
2-[cyanomethyl-[6-(N-ethylanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile (PubChem CID 23478204) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-(N-ethylanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-(N-ethylanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 23478204 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[cyanomethyl-[6-(N-ethylanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile |
| SMILES | CCN(c1ccccc1)c1ncnc(N(CC#N)CC#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N7O2/c1-2-22(13-6-4-3-5-7-13)16-14(23(24)25)15(19-12-20-16)21(10-8-17)11-9-18/h3-7,12H,2,10-11H2,1H3 |
| InChIKey | GFFPLXJLOXADQF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 122.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|