C24H23N5O2 — CID 23478158
4-N,6-N-diethyl-4-N-naphthalen-1-yl-5-nitro-6-N-phenylpyrimidine-4,6-diamine (PubChem CID 23478158) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-N,6-N-diethyl-4-N-naphthalen-1-yl-5-nitro-6-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-diethyl-4-N-naphthalen-1-yl-5-nitro-6-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478158 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4-N,6-N-diethyl-4-N-naphthalen-1-yl-5-nitro-6-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1ncnc(N(CC)c2cccc3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N5O2/c1-3-27(19-13-6-5-7-14-19)23-22(29(30)31)24(26-17-25-23)28(4-2)21-16-10-12-18-11-8-9-15-20(18)21/h5-17H,3-4H2,1-2H3 |
| InChIKey | DTDXYVRZDOYPLC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|