C26H26N6O2 — CID 23484369
N-ethyl-N-naphthalen-1-yl-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 23484369) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-ethyl-N-naphthalen-1-yl-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-ethyl-N-naphthalen-1-yl-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23484369 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N-ethyl-N-naphthalen-1-yl-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCN(c1ncnc(N2CCN(c3ccccc3)CC2)c1[N+](=O)[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C26H26N6O2/c1-2-31(23-14-8-10-20-9-6-7-13-22(20)23)26-24(32(33)34)25(27-19-28-26)30-17-15-29(16-18-30)21-11-4-3-5-12-21/h3-14,19H,2,15-18H2,1H3 |
| InChIKey | NOYNVYAPJZLXDU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|