C23H27N5O2 — CID 23484380
N-ethyl-6-(2-ethylpiperidin-1-yl)-N-naphthalen-1-yl-5-nitropyrimidin-4-amine (PubChem CID 23484380) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-ethyl-6-(2-ethylpiperidin-1-yl)-N-naphthalen-1-yl-5-nitropyrimidin-4-amine.
| Compound Name | N-ethyl-6-(2-ethylpiperidin-1-yl)-N-naphthalen-1-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23484380 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-ethyl-6-(2-ethylpiperidin-1-yl)-N-naphthalen-1-yl-5-nitropyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1ncnc(N(CC)c2cccc3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N5O2/c1-3-18-12-7-8-15-27(18)23-21(28(29)30)22(24-16-25-23)26(4-2)20-14-9-11-17-10-5-6-13-19(17)20/h5-6,9-11,13-14,16,18H,3-4,7-8,12,15H2,1-2H3 |
| InChIKey | BTGPJJBKCITCSM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|