C23H26N6O2 — CID 23492446
2-[6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine (PubChem CID 23492446) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine.
| Compound Name | 2-[6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 23492446 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
| SMILES | CCC1CCCCN1c1ncnc(NN(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N6O2/c1-2-18-11-9-10-16-27(18)23-21(29(30)31)22(24-17-25-23)26-28(19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-8,12-15,17-18H,2,9-11,16H2,1H3,(H,24,25,26) |
| InChIKey | KOCWZSLBXJCLBO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|