C22H24N6O2 — CID 23489744
2-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine (PubChem CID 23489744) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine.
| Compound Name | 2-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 23489744 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
| SMILES | O=[N+]([O-])c1c(NN(c2ccccc2)c2ccccc2)ncnc1N1CCCCCC1 |
| InChI | InChI=1S/C22H24N6O2/c29-28(30)20-21(23-17-24-22(20)26-15-9-1-2-10-16-26)25-27(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17H,1-2,9-10,15-16H2,(H,23,24,25) |
| InChIKey | GDUHVDHUCDTYGA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|