C20H22N6O2 — CID 23478725
N-tert-butyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine (PubChem CID 23478725) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-tert-butyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine.
| Compound Name | N-tert-butyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23478725 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-tert-butyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)Nc1ncnc(NN(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N6O2/c1-20(2,3)23-18-17(26(27)28)19(22-14-21-18)24-25(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,1-3H3,(H2,21,22,23,24) |
| InChIKey | YUKRRRCTCYMWHD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|