C21H19N7O2 — CID 22530763
2-[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine (PubChem CID 22530763) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 2-[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine.
| Compound Name | 2-[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 22530763 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
| SMILES | Cc1cc(C)n(-c2ncnc(NN(c3ccccc3)c3ccccc3)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H19N7O2/c1-15-13-16(2)26(24-15)21-19(28(29)30)20(22-14-23-21)25-27(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,1-2H3,(H,22,23,25) |
| InChIKey | XXPIRYURUPLGID-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|