C23H18N8O5 — CID 22530681
N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide (PubChem CID 22530681) has the molecular formula C23H18N8O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide.
| Compound Name | N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22530681 |
| Molecular Formula | C23H18N8O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NN(c2ccccc2)c2ccccc2)c1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N8O5/c32-23(16-11-13-19(14-12-16)30(33)34)27-26-21-20(31(35)36)22(25-15-24-21)28-29(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H,(H,27,32)(H2,24,25,26,28) |
| InChIKey | PJVMBIIAQWMDAF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|