C23H20N6O2 — CID 23488128
N-benzyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine (PubChem CID 23488128) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-benzyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine.
| Compound Name | N-benzyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488128 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-benzyl-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2)ncnc1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N6O2/c30-29(31)21-22(24-16-18-10-4-1-5-11-18)25-17-26-23(21)27-28(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17H,16H2,(H2,24,25,26,27) |
| InChIKey | VUVJGPMVHBWWBT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|