C22H25N7O2 — CID 23491346
3-[[6-(4-benzylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile (PubChem CID 23491346) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[[6-(4-benzylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile.
| Compound Name | 3-[[6-(4-benzylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 23491346 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-[[6-(4-benzylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ncnc(N2CCC(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N7O2/c23-10-4-12-27(13-5-11-24)21-20(29(30)31)22(26-17-25-21)28-14-8-19(9-15-28)16-18-6-2-1-3-7-18/h1-3,6-7,17,19H,4-5,8-9,12-16H2 |
| InChIKey | QFYKQEKKQLVANQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 122.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|