C22H21Cl2N5O2 — CID 23491413
6-(4-benzylpiperidin-1-yl)-N-(2,4-dichlorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 23491413) has the molecular formula C22H21Cl2N5O2 and a molecular weight of 458.35 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-(2,4-dichlorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-(2,4-dichlorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491413 |
| Molecular Formula | C22H21Cl2N5O2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-(2,4-dichlorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Cl)cc2Cl)ncnc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H21Cl2N5O2/c23-17-6-7-19(18(24)13-17)27-21-20(29(30)31)22(26-14-25-21)28-10-8-16(9-11-28)12-15-4-2-1-3-5-15/h1-7,13-14,16H,8-12H2,(H,25,26,27) |
| InChIKey | AKSXTRSPHSYHMX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|