C16H14BrN7O2 — CID 23493552
3-[[6-(3-bromoanilino)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile (PubChem CID 23493552) has the molecular formula C16H14BrN7O2 and a molecular weight of 416.24 g/mol. Its IUPAC name is 3-[[6-(3-bromoanilino)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile.
| Compound Name | 3-[[6-(3-bromoanilino)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 23493552 |
| Molecular Formula | C16H14BrN7O2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-[[6-(3-bromoanilino)-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ncnc(Nc2cccc(Br)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14BrN7O2/c17-12-4-1-5-13(10-12)22-15-14(24(25)26)16(21-11-20-15)23(8-2-6-18)9-3-7-19/h1,4-5,10-11H,2-3,8-9H2,(H,20,21,22) |
| InChIKey | LLKKBIVERZPOCR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|