C17H18N8O4S — CID 23493538
N'-[6-[bis(2-cyanoethyl)amino]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 23493538) has the molecular formula C17H18N8O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is N'-[6-[bis(2-cyanoethyl)amino]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[6-[bis(2-cyanoethyl)amino]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 23493538 |
| Molecular Formula | C17H18N8O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N'-[6-[bis(2-cyanoethyl)amino]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(N(CCC#N)CCC#N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N8O4S/c1-13-4-6-14(7-5-13)30(28,29)23-22-16-15(25(26)27)17(21-12-20-16)24(10-2-8-18)11-3-9-19/h4-7,12,23H,2-3,10-11H2,1H3,(H,20,21,22) |
| InChIKey | QXPJNRGUYHPWCF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 177.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|