C14H14N8O3 — CID 23478927
3-[2-cyanoethyl-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]propanenitrile (PubChem CID 23478927) has the molecular formula C14H14N8O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 3-[2-cyanoethyl-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[2-cyanoethyl-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 23478927 |
| Molecular Formula | C14H14N8O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-[2-cyanoethyl-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]propanenitrile |
| SMILES | Cc1cc(Nc2ncnc(N(CCC#N)CCC#N)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C14H14N8O3/c1-10-8-11(20-25-10)19-13-12(22(23)24)14(18-9-17-13)21(6-2-4-15)7-3-5-16/h8-9H,2-3,6-7H2,1H3,(H,17,18,19,20) |
| InChIKey | BAZVFBNZXLURMO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|