C13H9BrN8O2 — CID 23493311
2-[[6-[(5-bromo-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile (PubChem CID 23493311) has the molecular formula C13H9BrN8O2 and a molecular weight of 389.17 g/mol. Its IUPAC name is 2-[[6-[(5-bromo-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[6-[(5-bromo-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 23493311 |
| Molecular Formula | C13H9BrN8O2 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 2-[[6-[(5-bromo-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1ncnc(Nc2ccc(Br)cn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9BrN8O2/c14-9-1-2-10(17-7-9)20-12-11(22(23)24)13(19-8-18-12)21(5-3-15)6-4-16/h1-2,7-8H,5-6H2,(H,17,18,19,20) |
| InChIKey | UWVRVRFWYCZQKD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|