C15H12N8O3 — CID 23493345
N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23493345) has the molecular formula C15H12N8O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23493345 |
| Molecular Formula | C15H12N8O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | N#CCN(CC#N)c1ncnc(NNC(=O)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N8O3/c16-6-8-22(9-7-17)14-12(23(25)26)13(18-10-19-14)20-21-15(24)11-4-2-1-3-5-11/h1-5,10H,8-9H2,(H,21,24)(H,18,19,20) |
| InChIKey | RKXYQECSNGOQNQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 160.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|